cumenesulphonic acid, compound with 2-aminoethanol (1:1) structure
|
Common Name | cumenesulphonic acid, compound with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93904-95-1 | Molecular Weight | 261.33800 | |
| Density | N/A | Boiling Point | 481.1ºC at 760mmHg | |
| Molecular Formula | C11H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-aminoethanol,2-propan-2-ylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 481.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.33800 |
| Exact Mass | 261.10300 |
| PSA | 109.00000 |
| LogP | 2.77520 |
| InChIKey | ABCSYOJZMJGCOO-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccccc1S(=O)(=O)O.NCCO |
| EINECS 299-830-6 |
| Cumenesulphonic acid,compound with 2-aminoethanol (1:1) |