2,2'-[[4-[(2-hydroxyethyl)amino]-2-nitrophenyl]imino]bisethanol structure
|
Common Name | 2,2'-[[4-[(2-hydroxyethyl)amino]-2-nitrophenyl]imino]bisethanol | ||
|---|---|---|---|---|
| CAS Number | 93919-22-3 | Molecular Weight | 285.29600 | |
| Density | 1.421g/cm3 | Boiling Point | 567.7ºC at 760 mmHg | |
| Molecular Formula | C12H19N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.2ºC | |
| Name | 2-[4-[bis(2-hydroxyethyl)amino]-3-nitroanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 567.7ºC at 760 mmHg |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.29600 |
| Flash Point | 297.2ºC |
| Exact Mass | 285.13200 |
| PSA | 121.78000 |
| LogP | 0.38620 |
| Index of Refraction | 1.672 |
| InChIKey | YASCOZNFOIEAHZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(NCCO)ccc1N(CCO)CCO |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 300-007-1 |
| 2,2'-[[4-[(2-hydroxyethyl)amino]-2-nitrophenyl]imino]bisethanol |