(8α,9R)-10,11-dihydro-8'-nitrocinchonan-9-ol, salt with sulphuric acid (1:2) structure
|
Common Name | (8α,9R)-10,11-dihydro-8'-nitrocinchonan-9-ol, salt with sulphuric acid (1:2) | ||
|---|---|---|---|---|
| CAS Number | 93919-36-9 | Molecular Weight | 535.54500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25N3O11S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(8-nitroquinolin-4-yl)methanol,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H25N3O11S2 |
|---|---|
| Molecular Weight | 535.54500 |
| Exact Mass | 535.09300 |
| PSA | 248.14000 |
| LogP | 4.38990 |
| InChIKey | ZYKWVBRBLRQCDC-UHFFFAOYSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2c([N+](=O)[O-])cccc12.O=S(=O)(O)O.O=S(=O)(O)O |
| (8alpha,9R)-10,11-Dihydro-8'-nitrocinchonan-9-ol,salt with sulphuric acid (1:2) |
| EINECS 300-021-8 |