methyl (3β,19α,20α)-16,17-didehydro-10,11-dimethoxy-19-methyloxayohimban-16-carboxylate, compound with ethanol (1:1) structure
|
Common Name | methyl (3β,19α,20α)-16,17-didehydro-10,11-dimethoxy-19-methyloxayohimban-16-carboxylate, compound with ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93919-58-5 | Molecular Weight | 458.54700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H34N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | einecs 300-042-2 |
|---|
| Molecular Formula | C25H34N2O6 |
|---|---|
| Molecular Weight | 458.54700 |
| Exact Mass | 458.24200 |
| PSA | 89.82000 |
| LogP | 2.43160 |
| InChIKey | APQHSINAUZSKTL-DRTPNGPJSA-N |
| SMILES | CCO.COC(=O)C1=COC(C)C2CN3CCC4C(=Nc5cc(OC)c(OC)cc54)C3CC12 |