2-(4-amino-3-nitrobenzoyl)benzoic acid structure
|
Common Name | 2-(4-amino-3-nitrobenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 93923-57-0 | Molecular Weight | 286.24000 | |
| Density | 1.473g/cm3 | Boiling Point | 590.4ºC at 760mmHg | |
| Molecular Formula | C14H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.9ºC | |
| Name | 2-(4-amino-3-nitrobenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 590.4ºC at 760mmHg |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24000 |
| Flash Point | 310.9ºC |
| Exact Mass | 286.05900 |
| PSA | 126.21000 |
| LogP | 3.21060 |
| Index of Refraction | 1.684 |
| InChIKey | NYGUWSCZBSDNCA-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccccc2C(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2922509090 |
|---|
|
~95%
2-(4-amino-3-ni... CAS#:93923-57-0 |
| Literature: EXELIXIS, INC.; JOSHI, Anagha, Abhijit Patent: WO2005/112932 A2, 2005 ; Location in patent: Page/Page column 65-68; 83-84 ; WO 2005/112932 A2 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-Amino-3-nitro-benzoyl)-benzoesaeure |
| 2-[(4-amino-3-nitrophenyl)carbonyl]benzoic acid |
| EINECS 300-145-2 |
| 2-(4-amino-3-nitro-benzoyl)-benzoic acid |
| 4'-amino-3'-nitrobenzophenone-2-carboxylic acid |