3,7-di-(tert-butyl)naphthalene-1,5-disulphonic acid, compound with [R-(R*,S*)]-1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propionate (1:2) structure
|
Common Name | 3,7-di-(tert-butyl)naphthalene-1,5-disulphonic acid, compound with [R-(R*,S*)]-1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propionate (1:2) | ||
|---|---|---|---|---|
| CAS Number | 93940-39-7 | Molecular Weight | 1079.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C62H82N2O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,7-ditert-butylnaphthalene-1,5-disulfonic acid,[(2R,3S)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C62H82N2O10S2 |
|---|---|
| Molecular Weight | 1079.45000 |
| Exact Mass | 1078.54000 |
| PSA | 184.58000 |
| LogP | 14.64080 |
| InChIKey | UMXCENAPRPMLOZ-OVEBCFDHSA-N |
| SMILES | CC(C)(C)c1cc(S(=O)(=O)O)c2cc(C(C)(C)C)cc(S(=O)(=O)O)c2c1.CCC(=O)OC(Cc1ccccc1)(c1ccccc1)C(C)CN(C)C.CCC(=O)OC(Cc1ccccc1)(c1ccccc1)C(C)CN(C)C |
| einecs 300-434-3 |