5-oxo-L-proline, compound with 2,3-dihydroxypropyl N-(7-chloro-4-quinolyl)anthranilate (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 2,3-dihydroxypropyl N-(7-chloro-4-quinolyl)anthranilate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93940-74-0 | Molecular Weight | 501.91600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24ClN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dihydroxypropyl 2-[(7-chloroquinolin-4-yl)amino]benzoate,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H24ClN3O7 |
|---|---|
| Molecular Weight | 501.91600 |
| Exact Mass | 501.13000 |
| PSA | 161.57000 |
| LogP | 2.84030 |
| InChIKey | AKGMPKHOXWVKGB-HVDRVSQOSA-N |
| SMILES | O=C(OCC(O)CO)c1ccccc1Nc1ccnc2cc(Cl)ccc12.O=C1CCC(C(=O)O)N1 |
| einecs 300-473-6 |