5-oxo-L-proline, compound with [7(S)-(1α,2β,4β,5α,7β)]-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl α-(hydroxymethyl)benzeneacetate (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with [7(S)-(1α,2β,4β,5α,7β)]-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl α-(hydroxymethyl)benzeneacetate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93940-86-4 | Molecular Weight | 432.46700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | einecs 300-486-7 |
|---|
| Molecular Formula | C22H28N2O7 |
|---|---|
| Molecular Weight | 432.46700 |
| Exact Mass | 432.19000 |
| PSA | 132.19000 |
| LogP | 0.48150 |
| InChIKey | SRPUCLKSHDNYFS-CLDMHORGSA-N |
| SMILES | CN1C2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC12.O=C1CCC(C(=O)O)N1 |