cinnamic acid, compound with piperazine-1-ethylamine (1:1) structure
|
Common Name | cinnamic acid, compound with piperazine-1-ethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93942-32-6 | Molecular Weight | 277.36200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-3-phenylprop-2-enoic acid,2-piperazin-1-ylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23N3O2 |
|---|---|
| Molecular Weight | 277.36200 |
| Exact Mass | 277.17900 |
| PSA | 78.59000 |
| LogP | 1.60170 |
| InChIKey | XMFHHSFDRRZBRV-UHDJGPCESA-N |
| SMILES | NCCN1CCNCC1.O=C(O)C=Cc1ccccc1 |
| EINECS 300-583-4 |
| Cinnamic acid,compound with piperazine-1-ethylamine (1:1) |