ethyl 2-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate structure
|
Common Name | ethyl 2-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 93963-29-2 | Molecular Weight | 242.31300 | |
| Density | 1.125g/cm3 | Boiling Point | 324.3ºC at 760mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143ºC | |
| Name | ethyl 5-phenylbicyclo[2.2.1]hept-2-ene-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 324.3ºC at 760mmHg |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 143ºC |
| Exact Mass | 242.13100 |
| PSA | 26.30000 |
| LogP | 3.08350 |
| Index of Refraction | 1.562 |
| InChIKey | OTAUMCQINVLSGE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CC2C=CC1C2 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Phenyl-bicyclo<2.2.1>hept-5-en-2-carbonsaeure-ethylester |
| EINECS 300-771-6 |
| Ethyl 2-phenylbicyclo(2.2.1)hept-5-ene-2-carboxylate |