2-phenylbicyclo[2.2.1]heptane-2-carboxylic acid structure
|
Common Name | 2-phenylbicyclo[2.2.1]heptane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 93963-31-6 | Molecular Weight | 216.27600 | |
| Density | 1.201g/cm3 | Boiling Point | 372.8ºC at 760mmHg | |
| Molecular Formula | C14H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.5ºC | |
| Name | 3-phenylbicyclo[2.2.1]heptane-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760mmHg |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.27600 |
| Flash Point | 172.5ºC |
| Exact Mass | 216.11500 |
| PSA | 37.30000 |
| LogP | 2.82900 |
| Index of Refraction | 1.59 |
| InChIKey | FODOCVXEWGKNJA-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccccc2)CC2CCC1C2 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Phenyl-bicyclo[2.2.1]heptan-2-carbonsaeure |
| Bicyclo[2.2.1]heptane-2-carboxylicacid,2-phenyl |
| 2-PHENYLBICYCLO[2.2.1]HEPTANE-2-CARBOXYLIC ACID |
| EINECS 300-773-7 |