5-oxo-L-proline, compound with 4,5-dihydro-2-(1,2,3,4-tetrahydro-1-naphthyl)-1H-imidazole (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 4,5-dihydro-2-(1,2,3,4-tetrahydro-1-naphthyl)-1H-imidazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93963-53-2 | Molecular Weight | 329.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-5-oxopyrrolidine-2-carboxylic acid,2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H23N3O3 |
|---|---|
| Molecular Weight | 329.39400 |
| Exact Mass | 329.17400 |
| PSA | 94.28000 |
| LogP | 1.49810 |
| InChIKey | KOUGRVVOGVFXJI-HVDRVSQOSA-N |
| SMILES | O=C1CCC(C(=O)O)N1.c1ccc2c(c1)CCCC2C1=NCCN1 |
| einecs 300-796-2 |