5-oxo-L-proline, compound with 10-[2-(dimethylamino)ethyl]-5,10-dihydro-5-methyl-11H-dibenzo[b,e][1,4]diazepin-11-one (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 10-[2-(dimethylamino)ethyl]-5,10-dihydro-5-methyl-11H-dibenzo[b,e][1,4]diazepin-11-one (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93963-57-6 | Molecular Weight | 424.49300 | |
| Density | N/A | Boiling Point | 691.5ºC at 760 mmHg | |
| Molecular Formula | C23H28N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372ºC | |
| Name | 5-[2-(dimethylamino)ethyl]-11-methylbenzo[b][1,4]benzodiazepin-6-one,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 691.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.49300 |
| Flash Point | 372ºC |
| Exact Mass | 424.21100 |
| PSA | 100.06000 |
| LogP | 2.24250 |
| InChIKey | MVFNCKFRCAIMNT-HVDRVSQOSA-N |
| SMILES | CN(C)CCN1C(=O)c2ccccc2N(C)c2ccccc21.O=C1CCC(C(=O)O)N1 |
| einecs 300-800-2 |