5-oxo-L-proline, compound with ()-α-methylbenzeneethylamine (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with ()-α-methylbenzeneethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93963-60-1 | Molecular Weight | 264.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-5-oxopyrrolidine-2-carboxylic acid,1-phenylpropan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20N2O3 |
|---|---|
| Molecular Weight | 264.32000 |
| Exact Mass | 264.14700 |
| PSA | 95.91000 |
| LogP | 1.90210 |
| InChIKey | ABJBJEPRFKUEMJ-HVDRVSQOSA-N |
| SMILES | CC(N)Cc1ccccc1.O=C1CCC(C(=O)O)N1 |
| Amphetamine mixture with pidolic acid |
| EINECS 300-803-9 |