5-oxo-L-proline, compound with 1-(1-benzylbutyl)pyrrolidine (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 1-(1-benzylbutyl)pyrrolidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93963-64-5 | Molecular Weight | 346.46400 | |
| Density | N/A | Boiling Point | 557.9ºC at 760 mmHg | |
| Molecular Formula | C20H30N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.2ºC | |
| Name | (2S)-5-oxopyrrolidine-2-carboxylic acid,1-(1-phenylpentan-2-yl)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 557.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.46400 |
| Flash Point | 291.2ºC |
| Exact Mass | 346.22600 |
| PSA | 73.13000 |
| LogP | 3.05700 |
| InChIKey | UZAHXMKUBVQSKM-HVDRVSQOSA-N |
| SMILES | CCCC(Cc1ccccc1)N1CCCC1.O=C1CCC(C(=O)O)N1 |
| einecs 300-808-6 |