cinnamic acid, compound with 1-aminopropan-2-ol (1:1) structure
|
Common Name | cinnamic acid, compound with 1-aminopropan-2-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93966-51-9 | Molecular Weight | 223.26800 | |
| Density | N/A | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 1-aminopropan-2-ol,(E)-3-phenylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 433.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 216.2ºC |
| Exact Mass | 223.12100 |
| PSA | 83.55000 |
| LogP | 1.81060 |
| InChIKey | COVABMBOJCPPPV-UHDJGPCESA-N |
| SMILES | CC(O)CN.O=C(O)C=Cc1ccccc1 |
| einecs 301-003-2 |