4-nitrophenyl 3-o-(a-d-mannopyranosyl)-a-d-mannopyranoside structure
|
Common Name | 4-nitrophenyl 3-o-(a-d-mannopyranosyl)-a-d-mannopyranoside | ||
|---|---|---|---|---|
| CAS Number | 93979-06-7 | Molecular Weight | 463.39000 | |
| Density | 1.7g/cm3 | Boiling Point | 814.5ºC at 760 mmHg | |
| Molecular Formula | C18H25NO13 | Melting Point | 144-148ºC | |
| MSDS | N/A | Flash Point | 446.4ºC | |
| Name | 4-Nitrophenyl 3-O-(α-D-mannopyranosyl)-α-D-mannopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 814.5ºC at 760 mmHg |
| Melting Point | 144-148ºC |
| Molecular Formula | C18H25NO13 |
| Molecular Weight | 463.39000 |
| Flash Point | 446.4ºC |
| Exact Mass | 463.13300 |
| PSA | 224.35000 |
| Index of Refraction | 1.67 |
| InChIKey | LBTDRWMZFQVCAR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC2OC(CO)C(O)C(OC3OC(CO)C(O)C(O)C3O)C2O)cc1 |
| Storage condition | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |
| Stability | Light, Moisture and Temperature Sensitive |
| man1-a-3man-a-opnp |