5-oxo-L-proline, compound with N-(α-methylphenethyl)-γ-phenylbenzenepropylamine (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with N-(α-methylphenethyl)-γ-phenylbenzenepropylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93981-68-1 | Molecular Weight | 458.59200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H34N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H34N2O3 |
|---|---|
| Molecular Weight | 458.59200 |
| Exact Mass | 458.25700 |
| PSA | 81.92000 |
| LogP | 5.44580 |
| InChIKey | LKUYDEBIWJKEQO-HVDRVSQOSA-N |
| SMILES | CC(Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1.O=C1CCC(C(=O)O)N1 |
| einecs 301-154-4 |