(R)-glycolic acid, compound with [S-(R*,S*)]-2-(methylamino)-1-phenylpropanol(1:1) structure
|
Common Name | (R)-glycolic acid, compound with [S-(R*,S*)]-2-(methylamino)-1-phenylpropanol(1:1) | ||
|---|---|---|---|---|
| CAS Number | 93982-06-0 | Molecular Weight | 241.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxyacetic acid,(1R,2S)-2-(methylamino)-1-phenylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19NO4 |
|---|---|
| Molecular Weight | 241.28400 |
| Exact Mass | 241.13100 |
| PSA | 89.79000 |
| LogP | 0.78210 |
| InChIKey | LKJUAHHNAYDBNM-GNAZCLTHSA-N |
| SMILES | CNC(C)C(O)c1ccccc1.O=C(O)CO |
| einecs 301-195-8 |