L-Histidine,1-(phenylmethyl)-, methyl ester, hydrochloride (1:2) structure
|
Common Name | L-Histidine,1-(phenylmethyl)-, methyl ester, hydrochloride (1:2) | ||
|---|---|---|---|---|
| CAS Number | 93983-56-3 | Molecular Weight | 295.76500 | |
| Density | 1.19g/cm3 | Boiling Point | 436.9ºC at 760mmHg | |
| Molecular Formula | C14H18ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | methyl 2-amino-3-(1-benzylimidazol-4-yl)propanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 436.9ºC at 760mmHg |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.76500 |
| Flash Point | 218ºC |
| Exact Mass | 295.10900 |
| PSA | 70.14000 |
| LogP | 2.47650 |
| Index of Refraction | 1.589 |
| InChIKey | ACAJLNMXSIOPSZ-GXKRWWSZSA-N |
| SMILES | COC(=O)C(N)Cc1cn(Cc2ccccc2)cn1.Cl.Cl |
|
~%
L-Histidine,1-(... CAS#:93983-56-3 |
| Literature: Matsumoto, Masaomi; Nicholas, Kenneth M. Journal of Organic Chemistry, 2007 , vol. 72, # 24 p. 9308 - 9313 |
|
~%
L-Histidine,1-(... CAS#:93983-56-3 |
| Literature: Theodoropoulos; Foelsch Acta Chemica Scandinavica (1947-1973), 1958 , vol. 12, p. 1955,1963 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| L-N1-benzylhistidine methyl ester dihydrochloride |