2,4,6-Trimethylpyriliumperchlorate
2,4,6-Trimethylpyriliumperchlorate structure
|
Common Name | 2,4,6-Trimethylpyriliumperchlorate | ||
|---|---|---|---|---|
| CAS Number | 940-93-2 | Molecular Weight | 222.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,6-trimethylpyrylium,perchlorate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11ClO5 |
|---|---|
| Molecular Weight | 222.62300 |
| Exact Mass | 222.03000 |
| PSA | 87.41000 |
| LogP | 2.70020 |
| InChIKey | SPTGLTSDLLDPOO-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)[o+]c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2932999099 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,6-trimethyl-pyranylium,perchlorate |
| 2,4,6-trimethyl-pyrylium,2.4.6-trimethyl-pyrylium perchlorate |
| 2,4,6-trimethylpyrilium tetrafluoroborate |
| 2,4,6-trimethylpyrylium chlorate(VII) |
| Pyrylium,2,4,6-trimethyl-,perchlorate |
| 2,4,6-Trimethyl-pyrylium,Perchlorat |
| 2,4,6-trimethylpyranium perchlorate |
| T0504-0670 |
| 2,4,6-trimethylpyrylium perchlorate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,4,6-trimethylpyrylium,perchlorate? |
| A: Polar surface area (PSA) of 2,4,6-trimethylpyrylium,perchlorate is 87.41000. |
| Q: What is the LogP of 2,4,6-trimethylpyrylium,perchlorate? |
| A: LogP of 2,4,6-trimethylpyrylium,perchlorate is 2.70020. |
| Q: What is the English name of 2,4,6-trimethylpyrylium,perchlorate? |
| A: The English name of 2,4,6-trimethylpyrylium,perchlorate is 2,4,6-trimethylpyrylium,perchlorate. |
| Q: What is the Chinese name of 940-93-2? |
| A: Chinese name of 940-93-2 is 940-93-2. |
| Q: What is the molecular weight of 2,4,6-trimethylpyrylium,perchlorate? |
| A: Molecular weight of 2,4,6-trimethylpyrylium,perchlorate is 222.62300. |
| Q: What English synonyms does 2,4,6-trimethylpyrylium,perchlorate have? |
| A: English synonyms of 2,4,6-trimethylpyrylium,perchlorate: 2,4,6-trimethyl-pyranylium,perchlorate, 2,4,6-trimethyl-pyrylium,2.4.6-trimethyl-pyrylium perchlorate, 2,4,6-trimethylpyrilium tetrafluoroborate, 2,4,6-trimethylpyrylium chlorate(VII), Pyrylium,2,4,6-trimethyl-,perchlorate, 2,4,6-Trimethyl-pyrylium,Perchlorat, 2,4,6-trimethylpyranium perchlorate, T0504-0670, 2,4,6-trimethylpyrylium perchlorate. |
| Q: What is the InChIKey of 2,4,6-trimethylpyrylium,perchlorate? |
| A: InChIKey of 2,4,6-trimethylpyrylium,perchlorate is SPTGLTSDLLDPOO-UHFFFAOYSA-M. |
| Q: What is the molecular formula of 2,4,6-trimethylpyrylium,perchlorate? |
| A: Molecular formula of 2,4,6-trimethylpyrylium,perchlorate is C8H11ClO5. |
| Q: What is the CAS number of 2,4,6-trimethylpyrylium,perchlorate? |
| A: CAS number of 2,4,6-trimethylpyrylium,perchlorate is 940-93-2. |
| Q: What is the SMILES notation of 2,4,6-trimethylpyrylium,perchlorate? |
| A: SMILES notation of 2,4,6-trimethylpyrylium,perchlorate is Cc1cc(C)[o+]c(C)c1.[O-][Cl+3]([O-])([O-])[O-]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |