1-Propanone,1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)- structure
|
Common Name | 1-Propanone,1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 94003-21-1 | Molecular Weight | 258.39800 | |
| Density | 0.931g/cm3 | Boiling Point | 362.8ºC at 760mmHg | |
| Molecular Formula | C18H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.1ºC | |
| Name | 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.931g/cm3 |
|---|---|
| Boiling Point | 362.8ºC at 760mmHg |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.39800 |
| Flash Point | 153.1ºC |
| Exact Mass | 258.19800 |
| PSA | 17.07000 |
| LogP | 4.93670 |
| Index of Refraction | 1.496 |
| InChIKey | MODAQLBDWNSQMS-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
|
~%
1-Propanone,1-(... CAS#:94003-21-1 |
| Literature: Wood,T.F. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 2248 - 2255 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1.1.4.4.6-Pentamethyl-7-propionyl-tetralin |