1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate structure
|
Common Name | 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 940809-05-2 | Molecular Weight | 412.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24N4O3S |
|---|---|
| Molecular Weight | 412.5 |
| InChIKey | JVGOQNIIRAHSQS-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)c1csc(NCc2ccccc2)n1)C(=O)NC1(C#N)CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate? |
| A: Molecular weight of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate is 412.5. |
| Q: What is the InChIKey of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate? |
| A: InChIKey of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate is JVGOQNIIRAHSQS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate? |
| A: Molecular formula of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate is C21H24N4O3S. |
| Q: What is the CAS number of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate? |
| A: CAS number of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate is 940809-05-2. |
| Q: What is the SMILES notation of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate? |
| A: SMILES notation of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate is CC(OC(=O)c1csc(NCc2ccccc2)n1)C(=O)NC1(C#N)CCCCC1. |
| Q: What is the English name of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate? |
| A: The English name of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate is 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-(benzylamino)-1,3-thiazole-4-carboxylate. |
| Q: What is the Chinese name of 940809-05-2? |
| A: Chinese name of 940809-05-2 is 940809-05-2. |