4,7(1H,8H)-Pteridinedione,2,3-dihydro-6-methyl-2-thioxo- structure
|
Common Name | 4,7(1H,8H)-Pteridinedione,2,3-dihydro-6-methyl-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 94088-97-8 | Molecular Weight | 210.21300 | |
| Density | 1.92g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H6N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-2-sulfanylidene-1,8-dihydropteridine-4,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.92g/cm3 |
|---|---|
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.21300 |
| Exact Mass | 210.02100 |
| PSA | 126.49000 |
| Index of Refraction | 1.895 |
| InChIKey | JZIIMNMIDVPMED-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(=O)[nH]c(=S)[nH]c2[nH]c1=O |
| HS Code | 2933990090 |
|---|
|
~%
4,7(1H,8H)-Pter... CAS#:94088-97-8 |
| Literature: Gal Journal of the American Chemical Society, 1950 , vol. 72, p. 3532 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Methyl-2-thioxo-2,3-dihydro-1H,8H-pteridin-4,7-dion |
| 6-methyl-2-thioxo-2,3-dihydro-1H,8H-pteridine-4,7-dione |
| HMS3085L03 |
| 2,3-Dihydro-6-methyl-2-thioxo-(1H,8H)-pteridine-4,7-dione |
| EINECS 302-099-9 |