4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 940948-30-1 | Molecular Weight | 418.637 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 541.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClIN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.0±32.9 °C | |
| Name | 1-(benzenesulfonyl)-4-chloro-2-iodopyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.0±60.0 °C at 760 mmHg |
| Molecular Formula | C13H8ClIN2O2S |
| Molecular Weight | 418.637 |
| Flash Point | 281.0±32.9 °C |
| Exact Mass | 417.903961 |
| PSA | 60.34000 |
| LogP | 4.20 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.745 |
| InChIKey | QOYGFOVKGYRFHN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)n1c(I)cc2c(Cl)ccnc21 |
| HS Code | 2933990090 |
|---|
|
~%
4-Chloro-2-iodo... CAS#:940948-30-1 |
| Literature: US2007/129364 A1, ; Page/Page column 80-81 ; US 20070129364 A1 |
|
~70%
4-Chloro-2-iodo... CAS#:940948-30-1 |
| Literature: Layek, Mohosin; Gajare, Vikas; Kalita, Dipak; Islam, Aminul; Mukkanti; Pal, Manojit Tetrahedron, 2009 , vol. 65, # 25 p. 4814 - 4819 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-BENZENESULFONYL-4-CHLORO-2-IODO-7-AZAINDOLE |
| 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-2-iodo-1-(phenylsulfonyl)- |
| 1-benzenesulfonyl-4-chloro-2-iodo-1H-pyrrolo-[2,3-b]pyridine |
| 1-(Benzenesulfonyl)-4-chloro-2-iodo-pyrrolo[2,3-b]pyridine |
| 4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| 1-(Phenylsulphonyl)-4-chloro-2-iodo-7-azaindole |