h-tyr-amc tfa structure
|
Common Name | h-tyr-amc tfa | ||
|---|---|---|---|---|
| CAS Number | 94099-57-7 | Molecular Weight | 338.35700 | |
| Density | 1.365g/cm3 | Boiling Point | 644ºC at 760 mmHg | |
| Molecular Formula | C19H18N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 343.3ºC | |
| Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 644ºC at 760 mmHg |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.35700 |
| Flash Point | 343.3ºC |
| Exact Mass | 338.12700 |
| PSA | 105.56000 |
| LogP | 3.08880 |
| Index of Refraction | 1.676 |
| InChIKey | NRGJYQDVMUOJLU-INIZCTEOSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(N)Cc3ccc(O)cc3)ccc12 |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| L-Tyrosine 7-amido-4-methylcoumarin |
| T-9100 |
| MFCD00057306 |