Cyclohexanecarboxamide,4,4-dimethyl-2,6-dioxo- structure
|
Common Name | Cyclohexanecarboxamide,4,4-dimethyl-2,6-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 941-70-8 | Molecular Weight | 183.20400 | |
| Density | 1.172g/cm3 | Boiling Point | 411.1ºC at 760mmHg | |
| Molecular Formula | C9H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 4,4-Dimethyl-2,6-dioxo-cyclohexanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760mmHg |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.20400 |
| Flash Point | 202.4ºC |
| Exact Mass | 183.09000 |
| PSA | 77.23000 |
| LogP | 0.74640 |
| Index of Refraction | 1.492 |
| InChIKey | CXYHFBSJWRHKML-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(C(N)=O)C(=O)C1 |
| HS Code | 2924199090 |
|---|
|
~%
Cyclohexanecarb... CAS#:941-70-8 |
| Literature: Tada, Masahiro; Takakuwa, Takako; Nagai, Masashi; Yoshii, Takao Agricultural and Biological Chemistry, 1990 , vol. 54, # 11 p. 3061 - 3063 |
|
~27%
Cyclohexanecarb... CAS#:941-70-8 |
| Literature: Bakibaev, A. A.; Filimonov, V. D. Journal of Organic Chemistry USSR (English Translation), 1991 , vol. 27, # 4 p. 736 - 740 Zhurnal Organicheskoi Khimii, 1991 , vol. 27, # 4 p. 854 - 859 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-carbamoyldimedone |
| 2-carbamoyl-5,5-dimethylcyclohexane-1,3-dione |
| 2-carbamoyl-5,5-dimethyl-1,3-cyclohexanedione |
| 2-Carbamoyl-5,5-dimethyl-1,3-cyclohexandion |
| 2-Carbamoyl-5,5-dimethyl-1,4-hexanedione |
| 2-Carbamoyl-dimedon |
| 4,4-dimethyl-2,6-dioxo-cyclohexane-1-carboxamide |
| 4.4-Dimethyl-cyclohexadion-(2.6)-carbonsaeureamid |
| 5,5-Dimethyl-2-carbamoyl-cyclohexan-1,3-dion |
| 2,6-diketo-4,4-dimethyl-cyclohexanecarboxamide |