Phenylalanine,N-(2-bromo-1-oxopropyl)- structure
|
Common Name | Phenylalanine,N-(2-bromo-1-oxopropyl)- | ||
|---|---|---|---|---|
| CAS Number | 94107-39-8 | Molecular Weight | 300.14800 | |
| Density | 1.48g/cm3 | Boiling Point | 489.6ºC at 760mmHg | |
| Molecular Formula | C12H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | 2-(2-bromopropanoylamino)-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 489.6ºC at 760mmHg |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.14800 |
| Flash Point | 249.9ºC |
| Exact Mass | 299.01600 |
| PSA | 66.40000 |
| LogP | 1.97280 |
| Index of Refraction | 1.576 |
| InChIKey | DMSBFCNMHVOUMI-UHFFFAOYSA-N |
| SMILES | CC(Br)C(=O)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 302-272-9 |