acetic acid,2-(trimethylsilylmethyl)prop-2-ene-1,1-diol structure
|
Common Name | acetic acid,2-(trimethylsilylmethyl)prop-2-ene-1,1-diol | ||
|---|---|---|---|---|
| CAS Number | 94111-05-4 | Molecular Weight | 280.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24O6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,2-(trimethylsilylmethyl)prop-2-ene-1,1-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H24O6Si |
|---|---|
| Molecular Weight | 280.39000 |
| Exact Mass | 280.13400 |
| PSA | 115.06000 |
| LogP | 1.37330 |
| InChIKey | BJSMXISFQXKYSO-UHFFFAOYSA-N |
| SMILES | C=C(C[Si](C)(C)C)C(O)O.CC(=O)O.CC(=O)O |
|
~69%
acetic acid,2-(... CAS#:94111-05-4 |
| Literature: Trost, Barry M.; Nanninga, Thomas N.; Satoh, Tsuyoshi Journal of the American Chemical Society, 1985 , vol. 107, # 3 p. 721 - 723 |
| 2-Propene-1,1-diol,2-[(trimethylsilyl)methyl]-,diacetate |