4-(4-bromophenyl)-4-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one structure
|
Common Name | 4-(4-bromophenyl)-4-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 941282-78-6 | Molecular Weight | 309.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-bromophenyl)-4-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13BrO3 |
|---|---|
| Molecular Weight | 309.15500 |
| Exact Mass | 308.00500 |
| PSA | 46.53000 |
| LogP | 2.34840 |
| InChIKey | XFJRNOBIJCKTEX-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(OCCO)(c2ccc(Br)cc2)C=C1 |
|
~35%
4-(4-bromopheny... CAS#:941282-78-6 |
| Literature: Gu, Qing; Rong, Zi-Qiang; Zheng, Chao; You, Shu-Li Journal of the American Chemical Society, 2010 , vol. 132, # 12 p. 4056 - 4057 |
| 2,5-cyclohexadien-1-one,4-(4-bromophenyl)-4-(2-hydroxyethoxy) |