4-(3-oxobutyl)phenyl benzoate
Modify Date: 2025-09-27 21:37:53
4-(3-oxobutyl)phenyl benzoate structure
|
Common Name | 4-(3-oxobutyl)phenyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 94135-08-7 | Molecular Weight | 268.30700 | |
| Density | 1.137g/cm3 | Boiling Point | 406.6ºC at 760mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.5ºC | |
| Name | [4-(3-oxobutyl)phenyl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 406.6ºC at 760mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 179.5ºC |
| Exact Mass | 268.11000 |
| PSA | 43.37000 |
| LogP | 3.42740 |
| Index of Refraction | 1.564 |
| InChIKey | SGCBNKSLSODZJZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1ccc(OC(=O)c2ccccc2)cc1 |
| HS Code | 2916310090 |
|---|
|
~88%
4-(3-oxobutyl)p... CAS#:94135-08-7 |
| Literature: Baranovsky, Alexander; Schmitt, Bettina; Fowler, Daniel J.; Schneider, Bernd Synthetic Communications, 2003 , vol. 33, # 6 p. 1019 - 1045 |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-(4-Benzoyloxy-phenyl)-butan-2-on |
| 4-(3-Oxobutyl)phenyl benzoate |
| EINECS 302-876-2 |
| 4-(4-benzoyloxyphenyl)-butan-2-one |
| 4-Benzoyloxy-benzylaceton |