p-tert-butylbenzoic acid, compound with morpholine (1:1) structure
|
Common Name | p-tert-butylbenzoic acid, compound with morpholine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94135-64-5 | Molecular Weight | 265.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butylbenzoic acid,morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.34800 |
| Exact Mass | 265.16800 |
| PSA | 58.56000 |
| LogP | 2.61730 |
| InChIKey | FQWQFGBMJNQREU-UHFFFAOYSA-N |
| SMILES | C1COCCN1.CC(C)(C)c1ccc(C(=O)O)cc1 |
| p-tert-Butylbenzoic acid,compound with morpholine (1:1) |
| EINECS 302-934-7 |