1-[[(5-nitro-2-furyl)methylene]amino]imidazolidine-2,4-dione, compound with morpholine (1:1) structure
|
Common Name | 1-[[(5-nitro-2-furyl)methylene]amino]imidazolidine-2,4-dione, compound with morpholine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94135-68-9 | Molecular Weight | 325.27700 | |
| Density | N/A | Boiling Point | 500.2ºC at 760mmHg | |
| Molecular Formula | C12H15N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.3ºC | |
| Name | 1-{[(5-Nitro-2-furyl)methylene]amino}-2,4-imidazolidinedione-mo rpholine (1:1) |
|---|
| Boiling Point | 500.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H15N5O6 |
| Molecular Weight | 325.27700 |
| Flash Point | 256.3ºC |
| Exact Mass | 325.10200 |
| PSA | 145.48000 |
| LogP | 0.74550 |
| InChIKey | SASQWGSOPMXZAD-JSGFVSQVSA-N |
| SMILES | C1COCCN1.O=C1CN(N=Cc2ccc([N+](=O)[O-])o2)C(=O)N1 |