o-[(3-hydroxy[1,1'-biphenyl]-4-yl)carbonyl]benzoic acid, compound with 1-[2-(4-chlorobenzhydryloxy)ethyl]piperidine (1:1) structure
|
Common Name | o-[(3-hydroxy[1,1'-biphenyl]-4-yl)carbonyl]benzoic acid, compound with 1-[2-(4-chlorobenzhydryloxy)ethyl]piperidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94135-79-2 | Molecular Weight | 648.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H38ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-[(4-chlorophenyl)-phenylmethoxy]ethyl]piperidine,2-(2-hydroxy-4-phenylbenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H38ClNO5 |
|---|---|
| Molecular Weight | 648.18600 |
| Exact Mass | 647.24400 |
| PSA | 87.07000 |
| LogP | 8.85820 |
| InChIKey | OXBHZZODWNMYEV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(OCCN2CCCCC2)c2ccccc2)cc1.O=C(O)c1ccccc1C(=O)c1ccc(-c2ccccc2)cc1O |
| EINECS 302-949-9 |
| o-((3-Hydroxy(1,1'-biphenyl)-4-yl)carbonyl)benzoic acid,compound with 1-(2-(4-chlorobenzhydryloxy)ethyl)piperidine (1:1) |