DL-serine dihydrogen phosphate, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) structure
|
Common Name | DL-serine dihydrogen phosphate, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94135-82-7 | Molecular Weight | 372.26600 | |
| Density | N/A | Boiling Point | 928.8ºC at 760 mmHg | |
| Molecular Formula | C11H21N2O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 515.5ºC | |
| Name | 2-amino-3-phosphonooxypropanoic acid,4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 928.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H21N2O10P |
| Molecular Weight | 372.26600 |
| Flash Point | 515.5ºC |
| Exact Mass | 372.09300 |
| PSA | 244.70000 |
| InChIKey | RBCRYVINMLSEJR-UHFFFAOYSA-N |
| SMILES | Cc1ncc(CO)c(CO)c1O.NC(COP(=O)(O)O)C(=O)O |
| einecs 302-953-0 |