4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one, compound with 2-(diethylamino)ethanol (1:1) structure
|
Common Name | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one, compound with 2-(diethylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94135-89-4 | Molecular Weight | 425.51700 | |
| Density | N/A | Boiling Point | 614.4ºC at 760 mmHg | |
| Molecular Formula | C25H31NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.4ºC | |
| Name | 2-(diethylamino)ethanol,4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 614.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.51700 |
| Flash Point | 325.4ºC |
| Exact Mass | 425.22000 |
| PSA | 90.98000 |
| LogP | 3.93010 |
| InChIKey | HTEAUBWQNCREDM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccccc1)c1c(O)c2ccccc2oc1=O.CCN(CC)CCO |
| einecs 302-960-9 |