[3-[(2-hydroxynaphthyl)azo]phenyl]dimethylammonium methyl sulphate structure
|
Common Name | [3-[(2-hydroxynaphthyl)azo]phenyl]dimethylammonium methyl sulphate | ||
|---|---|---|---|---|
| CAS Number | 94136-08-0 | Molecular Weight | 403.452 | |
| Density | N/A | Boiling Point | 648.4±0.0 °C at 760 mmHg | |
| Molecular Formula | C19H21N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.9±0.0 °C | |
| Name | (3-((2-Hydroxynaphthyl)azo)phenyl)dimethylammonium methyl sulphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 648.4±0.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.452 |
| Flash Point | 345.9±0.0 °C |
| Exact Mass | 403.119995 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| InChIKey | XXSYFVOEXNKQDD-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)[O-].C[NH+](C)c1cccc(N=Nc2c(O)ccc3ccccc23)c1 |
| (3-((2-Hydroxynaphthyl)azo)phenyl)dimethylammonium methyl sulphate |
| Sulfuric acid, methyl ester, compd. with 1-[(E)-2-[3-(dimethylamino)phenyl]diazenyl]-2-naphthalenol (1:1) |
| 2-Naphthalenol, 1-[2-[3-(dimethylamino)phenyl]diazenyl]-, compd. with methyl hydrogen sulfate (1:1) |
| 3-[(E)-(2-Hydroxy-1-naphthyl)diazenyl]-N,N-dimethylanilinium methyl sulfate |