3,5-dibromo-2-hydroxybenzenesulphonic acid structure
|
Common Name | 3,5-dibromo-2-hydroxybenzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 94159-37-2 | Molecular Weight | 331.96700 | |
| Density | 2.321g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H4Br2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dibromo-2-hydroxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.321g/cm3 |
|---|---|
| Molecular Formula | C6H4Br2O4S |
| Molecular Weight | 331.96700 |
| Exact Mass | 329.82000 |
| PSA | 82.98000 |
| LogP | 3.24470 |
| Index of Refraction | 1.68 |
| InChIKey | FFWRVGFHKDCZQI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(Br)cc(Br)c1O |
| HS Code | 2908999090 |
|---|
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 303-216-6 |
| 3,5-dibromo-2-hydroxy-benzenesulfonic acid |
| 3,5-Dibrom-2-hydroxy-benzolsulfonsaeure |
| 3,5-Dibromo-2-hydroxybenzenesulphonic acid |