AKOS B028887 structure
|
Common Name | AKOS B028887 | ||
|---|---|---|---|---|
| CAS Number | 94169-57-0 | Molecular Weight | 228.67200 | |
| Density | 1.176g/cm3 | Boiling Point | 325.2ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.7ºC | |
| Name | 2-chloro-4-isopropoxy-5-methoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 325.2ºC at 760 mmHg |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67200 |
| Flash Point | 132.7ºC |
| Exact Mass | 228.05500 |
| PSA | 35.53000 |
| LogP | 2.94830 |
| Index of Refraction | 1.534 |
| InChIKey | ORZOULWZVFPKPE-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)c(Cl)cc1OC(C)C |
| HS Code | 2913000090 |
|---|
|
~%
AKOS B028887 CAS#:94169-57-0 |
| Literature: Carvalho, Christopher F.; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 8 p. 1913 - 1918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2-chloro-4-isopropoxy-5-methoxy-benzaldehyde |