(2,3,4,5,6-pentafluorophenyl) 1-(6-methylpyrazin-2-yl)piperidine-3-carboxylate structure
|
Common Name | (2,3,4,5,6-pentafluorophenyl) 1-(6-methylpyrazin-2-yl)piperidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 941716-83-2 | Molecular Weight | 387.30400 | |
| Density | 1.441g/cm3 | Boiling Point | 462.3ºC at 760 mmHg | |
| Molecular Formula | C17H14F5N3O2 | Melting Point | 76.5-78.5ºC | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | (2,3,4,5,6-pentafluorophenyl) 1-(6-methylpyrazin-2-yl)piperidine-3-carboxylate |
|---|
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760 mmHg |
| Melting Point | 76.5-78.5ºC |
| Molecular Formula | C17H14F5N3O2 |
| Molecular Weight | 387.30400 |
| Flash Point | 233.4ºC |
| Exact Mass | 387.10100 |
| PSA | 55.32000 |
| LogP | 3.36750 |
| Index of Refraction | 1.529 |
| InChIKey | CDEUDOARBGUKPM-UHFFFAOYSA-N |
| SMILES | Cc1cncc(N2CCCC(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)C2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |