1-(4-(4-Chlorobenzo[d]thiazol-2-yl)piperazin-1-yl)-4-((4-methoxyphenyl)sulfonyl)butan-1-one structure
|
Common Name | 1-(4-(4-Chlorobenzo[d]thiazol-2-yl)piperazin-1-yl)-4-((4-methoxyphenyl)sulfonyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 941907-16-0 | Molecular Weight | 494.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24ClN3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-(4-Chlorobenzo[d]thiazol-2-yl)piperazin-1-yl)-4-((4-methoxyphenyl)sulfonyl)butan-1-one |
|---|
| Molecular Formula | C22H24ClN3O4S2 |
|---|---|
| Molecular Weight | 494.0 |
| InChIKey | KXDHBLLCUZVCLU-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)CCCC(=O)N2CCN(c3nc4c(Cl)cccc4s3)CC2)cc1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|