N-(3-cyanothiophen-2-yl)-2-((4-methoxyphenyl)sulfonyl)acetamide structure
|
Common Name | N-(3-cyanothiophen-2-yl)-2-((4-methoxyphenyl)sulfonyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 941908-07-2 | Molecular Weight | 336.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-cyanothiophen-2-yl)-2-((4-methoxyphenyl)sulfonyl)acetamide |
|---|
| Molecular Formula | C14H12N2O4S2 |
|---|---|
| Molecular Weight | 336.4 |
| InChIKey | JCIWQQHFQSFGQS-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)CC(=O)Nc2sccc2C#N)cc1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|