4-(N-cyclopentyl-N-methylsulfamoyl)-N-(5-(2,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl)benzamide structure
|
Common Name | 4-(N-cyclopentyl-N-methylsulfamoyl)-N-(5-(2,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 941959-75-7 | Molecular Weight | 454.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(N-cyclopentyl-N-methylsulfamoyl)-N-(5-(2,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl)benzamide |
|---|
| Molecular Formula | C23H26N4O4S |
|---|---|
| Molecular Weight | 454.5 |
| InChIKey | YGZFBJCAYSXGLL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nnc(NC(=O)c3ccc(S(=O)(=O)N(C)C4CCCC4)cc3)o2)c(C)c1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|