N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide
Modify Date: 2026-09-29 12:02:13
![N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide Structure](https://www.chemsrc.com/extcaspic/428/941971-97-7.png)
N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide structure
|
Common Name | N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 941971-97-7 | Molecular Weight | 472.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18F2N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H18F2N2O3S2 |
|---|---|
| Molecular Weight | 472.5 |
| InChIKey | KUJLUEQJEGHBSO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)N(Cc2ccccc2)c2nc3c(F)cc(F)cc3s2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide? |
| A: CAS number of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide is 941971-97-7. |
| Q: What is the molecular formula of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide? |
| A: Molecular formula of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide is C23H18F2N2O3S2. |
| Q: What is the Chinese name of 941971-97-7? |
| A: Chinese name of 941971-97-7 is 941971-97-7. |
| Q: What is the molecular weight of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide? |
| A: Molecular weight of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide is 472.5. |
| Q: What is the InChIKey of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide? |
| A: InChIKey of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide is KUJLUEQJEGHBSO-UHFFFAOYSA-N. |
| Q: What is the English name of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide? |
| A: The English name of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide is N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide. |
| Q: What is the SMILES notation of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide? |
| A: SMILES notation of N-benzyl-N-(4,6-difluorobenzo[d]thiazol-2-yl)-2-(4-(methylsulfonyl)phenyl)acetamide is CS(=O)(=O)c1ccc(CC(=O)N(Cc2ccccc2)c2nc3c(F)cc(F)cc3s2)cc1. |