N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide
Modify Date: 2025-08-21 18:43:44
N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide structure
|
Common Name | N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 941981-06-2 | Molecular Weight | 425.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H23N3O2S2 |
|---|---|
| Molecular Weight | 425.6 |
| InChIKey | AMFASNUFSPJGSF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CSc2nc(CC(=O)Nc3cccc(C)c3C)cs2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide? |
| A: SMILES notation of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide is Cc1ccc(NC(=O)CSc2nc(CC(=O)Nc3cccc(C)c3C)cs2)cc1. |
| Q: What is the molecular weight of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide? |
| A: Molecular weight of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide is 425.6. |
| Q: What is the molecular formula of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide? |
| A: Molecular formula of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide is C22H23N3O2S2. |
| Q: What is the CAS number of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide? |
| A: CAS number of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide is 941981-06-2. |
| Q: What is the English name of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide? |
| A: The English name of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide is N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide. |
| Q: What is the InChIKey of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide? |
| A: InChIKey of N-(2,3-dimethylphenyl)-2-(2-((2-oxo-2-(p-tolylamino)ethyl)thio)thiazol-4-yl)acetamide is AMFASNUFSPJGSF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 941981-06-2? |
| A: Chinese name of 941981-06-2 is 941981-06-2. |