2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide
Modify Date: 2026-09-28 19:51:22
2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide structure
|
Common Name | 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 941981-44-8 | Molecular Weight | 407.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O3S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17N3O3S3 |
|---|---|
| Molecular Weight | 407.5 |
| InChIKey | YZPORCPYUZUKAV-UHFFFAOYSA-N |
| SMILES | COc1cc(CSc2nc(CC(=O)Nc3nccs3)cs2)cc(OC)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide? |
| A: CAS number of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide is 941981-44-8. |
| Q: What is the Chinese name of 941981-44-8? |
| A: Chinese name of 941981-44-8 is 941981-44-8. |
| Q: What is the molecular formula of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide? |
| A: Molecular formula of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide is C17H17N3O3S3. |
| Q: What is the English name of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide? |
| A: The English name of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide is 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide. |
| Q: What is the InChIKey of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide? |
| A: InChIKey of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide is YZPORCPYUZUKAV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide? |
| A: SMILES notation of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide is COc1cc(CSc2nc(CC(=O)Nc3nccs3)cs2)cc(OC)c1. |
| Q: What is the molecular weight of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide? |
| A: Molecular weight of 2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)-N-(thiazol-2-yl)acetamide is 407.5. |