2-(2-{[(4-chlorophenyl)methyl]sulfanyl}-1,3-thiazol-4-yl)-N-(3-methylbutyl)acetamide structure
|
Common Name | 2-(2-{[(4-chlorophenyl)methyl]sulfanyl}-1,3-thiazol-4-yl)-N-(3-methylbutyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 941981-95-9 | Molecular Weight | 368.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21ClN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-{[(4-chlorophenyl)methyl]sulfanyl}-1,3-thiazol-4-yl)-N-(3-methylbutyl)acetamide |
|---|
| Molecular Formula | C17H21ClN2OS2 |
|---|---|
| Molecular Weight | 368.9 |
| InChIKey | LHWDHPPZVHSHFW-UHFFFAOYSA-N |
| SMILES | CC(C)CCNC(=O)Cc1csc(SCc2ccc(Cl)cc2)n1 |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|