1-benzyl-3-carboxypyridinium chloride, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | 1-benzyl-3-carboxypyridinium chloride, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94199-83-4 | Molecular Weight | 398.88100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzylpyridin-1-ium-3-carboxylic acid,2-[bis(2-hydroxyethyl)amino]ethanol,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H27ClN2O5 |
|---|---|
| Molecular Weight | 398.88100 |
| Exact Mass | 398.16100 |
| PSA | 107.94000 |
| InChIKey | OHJHAXVQIIDOHQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc[n+](Cc2ccccc2)c1.OCCN(CCO)CCO.[Cl-] |
| EINECS 303-458-2 |
| 1-Benzyl-3-carboxypyridinium chloride,compound with 2,2',2''-nitrilotriethanol (1:1) |