[[[3-[methyl(phosphonomethyl)amino]propyl]imino]bis(methylene)]bisphosphonic acid structure
|
Common Name | [[[3-[methyl(phosphonomethyl)amino]propyl]imino]bis(methylene)]bisphosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 94200-40-5 | Molecular Weight | 370.17100 | |
| Density | 1.713g/cm3 | Boiling Point | 703.9ºC at 760mmHg | |
| Molecular Formula | C7H21N2O9P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379.5ºC | |
| Name | [3-[bis(phosphonomethyl)amino]propyl-methylamino]methylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.713g/cm3 |
|---|---|
| Boiling Point | 703.9ºC at 760mmHg |
| Molecular Formula | C7H21N2O9P3 |
| Molecular Weight | 370.17100 |
| Flash Point | 379.5ºC |
| Exact Mass | 370.04600 |
| PSA | 208.50000 |
| Index of Refraction | 1.578 |
| InChIKey | VAQXWQNIWWHADW-UHFFFAOYSA-N |
| SMILES | CN(CCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
|
~71%
[[[3-[methyl(ph... CAS#:94200-40-5 |
| Literature: Villemin, Didier; Moreau, Bernard; Elbilali, Abdelghani; Didi, Mohamed-Amine; Kaid, Mhamed; Jaffres, Paul-Alain Phosphorus, Sulfur and Silicon and the Related Elements, 2010 , vol. 185, # 12 p. 2511 - 2519 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (((3-(Methyl(phosphonomethyl)amino)propyl)imino)bis(methylene))bisphosphonic acid |
| 1-amino-3-methylaminopropane-N,N,N'-tris(methanephosphonic acid) |
| EINECS 303-517-2 |