N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide
Modify Date: 2026-07-11 15:29:41
N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide structure
|
Common Name | N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 942001-72-1 | Molecular Weight | 414.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H22N2O3S2 |
|---|---|
| Molecular Weight | 414.5 |
| InChIKey | WASDXYDRSUDWHU-UHFFFAOYSA-N |
| SMILES | COc1cc(CSc2nc(CC(=O)NCc3ccccc3)cs2)cc(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide? |
| A: SMILES notation of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide is COc1cc(CSc2nc(CC(=O)NCc3ccccc3)cs2)cc(OC)c1. |
| Q: What is the InChIKey of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide? |
| A: InChIKey of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide is WASDXYDRSUDWHU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 942001-72-1? |
| A: Chinese name of 942001-72-1 is 942001-72-1. |
| Q: What is the English name of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide? |
| A: The English name of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide is N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide. |
| Q: What is the CAS number of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide? |
| A: CAS number of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide is 942001-72-1. |
| Q: What is the molecular formula of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide? |
| A: Molecular formula of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide is C21H22N2O3S2. |
| Q: What is the molecular weight of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide? |
| A: Molecular weight of N-benzyl-2-(2-((3,5-dimethoxybenzyl)thio)thiazol-4-yl)acetamide is 414.5. |